Online Database of Chemicals from Around the World
|
CAS#: 120465-04-5 Product: O-Desmethylbrofaromine No suppilers available for the product. |
| Name | O-Desmethylbrofaromine |
|---|---|
| Synonyms | 7-Bromo-2-(4-Piperidyl)Benzofuran-5-Ol; 7-Bromo-2-(4-Piperidinyl)-5-Benzofuranol; 5-Benzofuranol, 7-Bromo-2-(4-Piperidinyl)- |
| Molecular Structure |  |
| Molecular Formula | C13H14BrNO2 |
| Molecular Weight | 296.16 |
| CAS Registry Number | 120465-04-5 |
| SMILES | C1=C(OC2=C(C=C(C=C12)O)Br)C3CCNCC3 |
| InChI | 1S/C13H14BrNO2/c14-11-7-10(16)5-9-6-12(17-13(9)11)8-1-3-15-4-2-8/h5-8,15-16H,1-4H2 |
| InChIKey | ROFOHNHESMVUGP-UHFFFAOYSA-N |
| Density | 1.494g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.198°C at 760 mmHg (Cal.) |
| Flash point | 212.162°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for O-Desmethylbrofaromine |