Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Biosynth AG. | Switzerland | Inquire | ||
|---|---|---|---|---|
|
+41 (71) 858-2020 | |||
|
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Name | Acetophenone O-(Carboxymethyl)Oxime |
|---|---|
| Synonyms | Carboxymethyl Oxyimino Acetophenone [French]; 3-07-00-00955 (Beilstein Handbook Reference); Acetophenone, O-(Carboxymethyl)Oxime |
| Molecular Structure |  |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 |
| CAS Registry Number | 1205-09-0 |
| SMILES | C1=C(C(=N/OCC(=O)O)\C)C=CC=C1 |
| InChI | 1S/C10H11NO3/c1-8(11-14-7-10(12)13)9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,12,13)/b11-8- |
| InChIKey | RCSPUQDYCFCXCV-FLIBITNWSA-N |
| Density | 1.137g/cm3 (Cal.) |
|---|---|
| Boiling point | 335.272°C at 760 mmHg (Cal.) |
| Flash point | 156.567°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Acetophenone O-(Carboxymethyl)Oxime |