Online Database of Chemicals from Around the World
|
CAS#: 120824-03-5 Product: Withangulatin A No suppilers available for the product. |
| Name | Withangulatin A |
|---|---|
| Synonyms | Withangulatin A |
| Molecular Structure |  |
| Molecular Formula | C30H38O8 |
| Molecular Weight | 526.63 |
| CAS Registry Number | 120824-03-5 |
| SMILES | [C@]236[C@@]([C@H]1CC[C@]4([C@]([C@@H]1C[C@H]2O3)([C@H](C=C4[C@@H]([C@@H]5OC(=O)C(=C(C5)C)C)C)OC(=O)C)O)C)(C(=O)C=C[C@@H]6O)C |
| InChI | 1S/C30H38O8/c1-14-11-21(37-26(34)15(14)2)16(3)19-12-24(36-17(4)31)29(35)20-13-25-30(38-25)23(33)8-7-22(32)28(30,6)18(20)9-10-27(19,29)5/h7-8,12,16,18,20-21,23-25,33,35H,9-11,13H2,1-6H3/t16-,18-,20+,21+,23-,24-,25+,27+,28-,29-,30+/m0/s1 |
| InChIKey | PLPXOWZTDPJPHC-ISIACCJKSA-N |
| Density | 1.334g/cm3 (Cal.) |
|---|---|
| Boiling point | 699.357°C at 760 mmHg (Cal.) |
| Flash point | 227.748°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Withangulatin A |