Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2,4,8-Trimethyldibenzo[b,d]Thiophene |
|---|---|
| Synonyms | 2,4,8-TRIMETHYLDIBENZOTHIOPHENE; Dibenzothiophene, 2,4,8-trimethyl; Dibenzothiophene, trimethyl- |
| Molecular Structure | ![CAS#: 1210-52-2， 2,4,8-Trimethyldibenzo[b,d]Thiophene](/moreStructures/1210-52-2.gif) |
| Molecular Formula | C15H14S |
| Molecular Weight | 226.34 |
| CAS Registry Number | 1210-52-2 |
| SMILES | s1c3c(c2cc(cc(c12)C)C)cc(cc3)C |
| InChI | 1S/C15H14S/c1-9-4-5-14-12(7-9)13-8-10(2)6-11(3)15(13)16-14/h4-8H,1-3H3 |
| InChIKey | FEQHEOIAYXXUHR-UHFFFAOYSA-N |
| Density | 1.155g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.114°C at 760 mmHg (Cal.) |
| Flash point | 137.356°C (Cal.) |
| Refractive index | 1.689 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,8-Trimethyldibenzo[b,d]Thiophene |