Online Database of Chemicals from Around the World
|
CAS#: 1212-50-6 Product: 4-(2-Phenylethyl)Benzaldehyde No suppilers available for the product. |
| Name | 4-(2-Phenylethyl)Benzaldehyde |
|---|---|
| Synonyms | Brn 1951578; Benzaldehyde, P-Phenethyl-; P-Phenethylbenzaldehyde |
| Molecular Structure |  |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 |
| CAS Registry Number | 1212-50-6 |
| SMILES | C1=C(C=CC(=C1)CCC2=CC=CC=C2)C=O |
| InChI | 1S/C15H14O/c16-12-15-10-8-14(9-11-15)7-6-13-4-2-1-3-5-13/h1-5,8-12H,6-7H2 |
| InChIKey | IVNWLIBLNSKBSD-UHFFFAOYSA-N |
| Density | 1.08g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.985°C at 760 mmHg (Cal.) |
| Flash point | 156.101°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2-Phenylethyl)Benzaldehyde |