Online Database of Chemicals from Around the World
|
CAS#: 121284-42-2 Product: 3-Acetamido-5-Iodoproflavine No suppilers available for the product. |
| Name | 3-Acetamido-5-Iodoproflavine |
|---|---|
| Synonyms | N-(6-Amino-5-Iodo-Acridin-3-Yl)Acetamide; N-(6-Amino-5-Iodo-3-Acridinyl)Acetamide; N-(6-Amino-5-Iodo-Acridin-3-Yl)Ethanamide |
| Molecular Structure |  |
| Molecular Formula | C15H12IN3O |
| Molecular Weight | 377.18 |
| CAS Registry Number | 121284-42-2 |
| SMILES | C1=C3C(=NC2=C(I)C(=CC=C12)N)C=C(NC(=O)C)C=C3 |
| InChI | 1S/C15H12IN3O/c1-8(20)18-11-4-2-9-6-10-3-5-12(17)14(16)15(10)19-13(9)7-11/h2-7H,17H2,1H3,(H,18,20) |
| InChIKey | MVLIXHWFINSYEI-UHFFFAOYSA-N |
| Density | 1.811g/cm3 (Cal.) |
|---|---|
| Boiling point | 629.133°C at 760 mmHg (Cal.) |
| Flash point | 334.287°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Acetamido-5-Iodoproflavine |