Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | cis-4-Cyanocyclohexanecarboxamide |
|---|---|
| Synonyms | (1s,4s)-4-cyanocyclohexanecarboxamide |
| Molecular Structure |  |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.19 |
| CAS Registry Number | 121487-72-7 |
| SMILES | C1[C@@H](CC[C@@H](C1)C(=O)N)C#N |
| InChI | 1S/C8H12N2O/c9-5-6-1-3-7(4-2-6)8(10)11/h6-7H,1-4H2,(H2,10,11)/t6-,7+ |
| InChIKey | CNJKDSZYFGSKDG-KNVOCYPGSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 391.7±31.0°C at 760 mmHg (Cal.) |
| Flash point | 190.7±24.8°C (Cal.) |
| Refractive index | 1.5 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for cis-4-Cyanocyclohexanecarboxamide |