|
CAS#: 1215-43-6 Product: 1,3-Diphenyl-3-Thioxo-1-Propanone No suppilers available for the product. |
| Name | 1,3-Diphenyl-3-Thioxo-1-Propanone |
|---|---|
| Synonyms | 1,3-Diphenyl-3-thioxo-1-propanone; Monothiodibenzoylmethane; ZINC00041774 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12OS |
| Molecular Weight | 240.32 |
| CAS Registry Number | 1215-43-6 |
| SMILES | S=C(c1ccccc1)CC(=O)c2ccccc2 |
| InChI | 1S/C15H12OS/c16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13/h1-10H,11H2 |
| InChIKey | CELMQLYNQRJGQX-UHFFFAOYSA-N |
| Density | 1.174g/cm3 (Cal.) |
|---|---|
| Boiling point | 390.617°C at 760 mmHg (Cal.) |
| Flash point | 190.039°C (Cal.) |
| Refractive index | 1.633 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Diphenyl-3-Thioxo-1-Propanone |