Online Database of Chemicals from Around the World
| Name | Dimethyl (4-Chloro-2,6-Pyridinediyl)Biscarbamate |
|---|---|
| Synonyms | 4-chloro-2,6-dimethoxycarbonylaminopyridine; dimethyl (4-chloropyridine-2,6-diyl)dicarbamate; Methyl 6-methoxyformamido-4-chloropyridin-2-ylcarbamate |
| Molecular Formula | C9H10ClN3O4 |
| Molecular Weight | 259.65 |
| CAS Registry Number | 121572-37-0 |
| SMILES | O=C(OC)Nc1nc(cc(Cl)c1)NC(=O)OC |
| InChI | 1S/C9H10ClN3O4/c1-16-8(14)12-6-3-5(10)4-7(11-6)13-9(15)17-2/h3-4H,1-2H3,(H2,11,12,13,14,15) |
| InChIKey | SFWTVMNXBYATBW-UHFFFAOYSA-N |
| Density | 1.497g/cm3 (Cal.) |
|---|---|
| Boiling point | 294.245°C at 760 mmHg (Cal.) |
| Flash point | 131.755°C (Cal.) |
| Refractive index | 1.624 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl (4-Chloro-2,6-Pyridinediyl)Biscarbamate |
