Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (2S,3R)-3-Phenyloxirane-2-Carbaldehyde |
|---|---|
| Synonyms | (2S,3R)-3-phenyloxirane-2-carbaldehyde |
| Molecular Structure |  |
| Molecular Formula | C9H8O2 |
| Molecular Weight | 148.16 |
| CAS Registry Number | 121651-02-3 |
| SMILES | O=C[C@H]2O[C@@H]2c1ccccc1 |
| InChI | 1S/C9H8O2/c10-6-8-9(11-8)7-4-2-1-3-5-7/h1-6,8-9H/t8-,9-/m1/s1 |
| InChIKey | MNDACYSEJXGHML-RKDXNWHRSA-N |
| Density | 1.288g/cm3 (Cal.) |
|---|---|
| Boiling point | 265.278°C at 760 mmHg (Cal.) |
| Flash point | 124.378°C (Cal.) |
| Refractive index | 1.648 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S,3R)-3-Phenyloxirane-2-Carbaldehyde |