Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (3aR,6aS)-Hexahydro-1H-Cyclopenta[c]Selenophene |
|---|---|
| Synonyms | (3aR,6aS)-hexahydro-1H-cyclopenta[c]selenophene |
| Molecular Structure | ![CAS#: 121887-64-7， (3aR,6aS)-Hexahydro-1H-Cyclopenta[c]Selenophene](/moreStructures/121887-64-7.gif) |
| Molecular Formula | C7H12Se |
| Molecular Weight | 175.13 |
| CAS Registry Number | 121887-64-7 |
| SMILES | C1C[C@@H]2C[Se]C[C@@H]2C1 |
| InChI | 1S/C7H12Se/c1-2-6-4-8-5-7(6)3-1/h6-7H,1-5H2/t6-,7+ |
| InChIKey | DXVINJMFIFPFRM-KNVOCYPGSA-N |
| Boiling point | 207.351°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 79.203°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3aR,6aS)-Hexahydro-1H-Cyclopenta[c]Selenophene |