Online Database of Chemicals from Around the World
| Fluorochem Ltd. | UK | Inquire | ||
|---|---|---|---|---|
 |
+44 (1457) 860-111 | |||
 |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Name | Methylchlorodisilanes.(Mixed) |
|---|---|
| Synonyms | Chloro-(Dichloro-Methyl-Silyl)-Dimethyl-Silane; 1,1,2-Trichloro-1,2,2-Trimethyldisilane; 1,1,2-Trimethyltrichlorodisilane |
| Molecular Structure |  |
| Molecular Formula | C3H9Cl3Si2 |
| Molecular Weight | 207.64 |
| CAS Registry Number | 12192-40-4 (13528-88-6) |
| SMILES | C[Si]([Si](C)(Cl)Cl)(C)Cl |
| InChI | 1S/C3H9Cl3Si2/c1-7(2,4)8(3,5)6/h1-3H3 |
| InChIKey | KTPJDYNQZVAFBU-UHFFFAOYSA-N |
| Density | 1.13g/cm3 (Cal.) |
|---|---|
| Boiling point | 159.194°C at 760 mmHg (Cal.) |
| Flash point | 47.556°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methylchlorodisilanes.(Mixed) |