Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (1R,2R)-2-Thiocyanatocyclopentyl Acetate |
|---|---|
| Synonyms | (1R,2R)-2-thiocyanatocyclopentyl acetate |
| Molecular Structure |  |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.24 |
| CAS Registry Number | 122060-04-2 |
| SMILES | CC(=O)O[C@@H]1CCC[C@H]1SC#N |
| InChI | 1S/C8H11NO2S/c1-6(10)11-7-3-2-4-8(7)12-5-9/h7-8H,2-4H2,1H3/t7-,8-/m1/s1 |
| InChIKey | HECAORXCPTXZCL-HTQZYQBOSA-N |
| Density | 1.196g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.949°C at 760 mmHg (Cal.) |
| Flash point | 127.342°C (Cal.) |
| Refractive index | 1.516 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,2R)-2-Thiocyanatocyclopentyl Acetate |