| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | AVN-492 |
|---|---|
| Synonyms | AVN-492; AVN 492; AVN492. 3-(benzenesulfonyl)-2-N,6-N,6-N,5,7-pentamethylpyrazolo[1,5-a]pyrimidine-2,6-diamine |
| Molecular Structure | ![]() |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.45 |
| CAS Registry Number | 1220646-23-0 |
| SMILES | CC1=C(C(=NC2=C(C(=NN12)NC)S(=O)(=O)C3=CC=CC=C3)C)N(C)C |
| InChI | 1S/C17H21N5O2S/c1-11-14(21(4)5)12(2)22-17(19-11)15(16(18-3)20-22)25(23,24)13-9-7-6-8-10-13/h6-10H,1-5H3,(H,18,20) |
| InChIKey | SNPPEHMSSOEYDH-UHFFFAOYSA-N |
| Density | 1.31±0.1g/cm3 (Expl.) |
|---|---|
| solubility | Soluble to ≥ 100 mg/mL in DMSO. |
| Market Analysis Reports |
| List of Reports Available for AVN-492 |