Online Database of Chemicals from Around the World
|
CAS#: 122168-71-2 Product: 5-(4-Methylaminophenylazo)Indazole No suppilers available for the product. |
| Name | 5-(4-Methylaminophenylazo)Indazole |
|---|---|
| Synonyms | 4-(1H-Indazol-5-Ylazo)-N-Methyl-Aniline; 4-(1H-Indazol-5-Ylazo)-N-Methylaniline; [4-(1H-Indazol-5-Ylazo)Phenyl]-Methyl-Amine |
| Molecular Structure |  |
| Molecular Formula | C14H13N5 |
| Molecular Weight | 251.29 |
| CAS Registry Number | 122168-71-2 |
| SMILES | C1=CC(=CC=C1NC)N=NC3=CC2=C([NH]N=C2)C=C3 |
| InChI | 1S/C14H13N5/c1-15-11-2-4-12(5-3-11)17-18-13-6-7-14-10(8-13)9-16-19-14/h2-9,15H,1H3,(H,16,19) |
| InChIKey | STPLHEAZDSWCBD-UHFFFAOYSA-N |
| Density | 1.288g/cm3 (Cal.) |
|---|---|
| Boiling point | 502.497°C at 760 mmHg (Cal.) |
| Flash point | 257.701°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(4-Methylaminophenylazo)Indazole |