Online Database of Chemicals from Around the World
|
CAS#: 122378-47-6 Product: 3-Deoxy-C(3)-Fluoromethyleneglucose No suppilers available for the product. |
| Name | 3-Deoxy-C(3)-Fluoromethyleneglucose |
|---|---|
| Synonyms | (3Z)-3-(Fluoromethylene)-2,4,5,6-Tetrahydroxy-Hexanal; (3Z)-3-(Fluoromethylene)-2,4,5,6-Tetrahydroxyhexanal; (Z)-4-Fluoro-2-Hydroxy-3-(1,2,3-Trihydroxypropyl)But-3-Enal |
| Molecular Structure |  |
| Molecular Formula | C7H11FO5 |
| Molecular Weight | 194.16 |
| CAS Registry Number | 122378-47-6 |
| SMILES | C(O)C(O)C(C(/C(O)C=O)=C/F)O |
| InChI | 1S/C7H11FO5/c8-1-4(5(11)2-9)7(13)6(12)3-10/h1-2,5-7,10-13H,3H2/b4-1+ |
| InChIKey | FLTGKRAXBIHWTK-DAFODLJHSA-N |
| Density | 1.477g/cm3 (Cal.) |
|---|---|
| Boiling point | 498.448°C at 760 mmHg (Cal.) |
| Flash point | 255.253°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Deoxy-C(3)-Fluoromethyleneglucose |