| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | 1,3-Bis[Bis(2-Pyridinylmethyl)Amino]-2-Propanol |
|---|---|
| Synonyms | 1,3-Bis[bis(2-pyridylmethyl)amino]-2-propanol solution; 1,3-bis[bis(pyridin-2-ylmethyl)amino]propan-2-ol; 2-Hydroxy |
| Molecular Structure | ![]() |
| Molecular Formula | C27H30N6O |
| Molecular Weight | 454.57 |
| CAS Registry Number | 122413-32-5 |
| SMILES | C1=CC=NC(=C1)CN(CC2=CC=CC=N2)CC(CN(CC3=CC=CC=N3)CC4=CC=CC=N4)O |
| InChI | 1S/C27H30N6O/c34-27(21-32(17-23-9-1-5-13-28-23)18-24-10-2-6-14-29-24)22-33(19-25-11-3-7-15-30-25)20-26-12-4-8-16-31-26/h1-16,27,34H,17-22H2 |
| InChIKey | XLUMWNJFCFABKI-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 643.2±55.0°C at 760 mmHg (Cal.) |
| Flash point | 342.8±31.5°C (Cal.) |
| Refractive index | 1.638 (Cal.) |
| (1) | Eiji Kinoshita, Makoto Takahashi, Hironori Takeda, Motoo Shiro and Tohru Koike. Recognition of phosphate monoester dianion by an alkoxide-bridged dinuclear zinc(ii) complex, Dalton Trans., 2004, 0, 1189. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,3-Bis[Bis(2-Pyridinylmethyl)Amino]-2-Propanol |