|
CAS#: 122630-66-4 Product: 3-{[(3E)-2-Methyl-4-(Trimethoxysilyl)-3-Buten-2-Yl]Oxy}-1-Propanamine No suppilers available for the product. |
| Name | 3-{[(3E)-2-Methyl-4-(Trimethoxysilyl)-3-Buten-2-Yl]Oxy}-1-Propanamine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H25NO4Si |
| Molecular Weight | 263.41 |
| CAS Registry Number | 122630-66-4 |
| SMILES | O(C)[Si](OC)(OC)/C=C/C(OCCCN)(C)C |
| InChI | 1S/C11H25NO4Si/c1-11(2,16-9-6-8-12)7-10-17(13-3,14-4)15-5/h7,10H,6,8-9,12H2,1-5H3/b10-7+ |
| InChIKey | BMVIHLQXGBMZNN-JXMROGBWSA-N |
| Density | 0.981g/cm3 (Cal.) |
|---|---|
| Boiling point | 294.522°C at 760 mmHg (Cal.) |
| Flash point | 131.922°C (Cal.) |
| Refractive index | 1.451 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-{[(3E)-2-Methyl-4-(Trimethoxysilyl)-3-Buten-2-Yl]Oxy}-1-Propanamine |