Online Database of Chemicals from Around the World
|
CAS#: 122739-10-0 Product: 9-Ethoxyaristolactone No suppilers available for the product. |
| Name | 9-Ethoxyaristolactone |
|---|---|
| Synonyms | 9-Ethoxyaristolactone; 9-Ethoxy-Aristololactone |
| Molecular Structure |  |
| Molecular Formula | C19H14O6 |
| Molecular Weight | 338.32 |
| CAS Registry Number | 122739-10-0 |
| SMILES | C1=CC(=C5C(=C1)C2=C4C(=CC3=C2OCO3)C(OC4=C5OCC)=O)OC |
| InChI | 1S/C19H14O6/c1-3-22-17-13-9(5-4-6-11(13)21-2)14-15-10(19(20)25-18(15)17)7-12-16(14)24-8-23-12/h4-7H,3,8H2,1-2H3 |
| InChIKey | UTAAFLZEDRWMGC-UHFFFAOYSA-N |
| Density | 1.457g/cm3 (Cal.) |
|---|---|
| Boiling point | 584.325°C at 760 mmHg (Cal.) |
| Flash point | 260.485°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Ethoxyaristolactone |