Online Database of Chemicals from Around the World
|
CAS#: 122853-28-5 Product: 5-Methoxyluzindole No suppilers available for the product. |
| Name | 5-Methoxyluzindole |
|---|---|
| Synonyms | N-[2-[2-(Benzyl)-5-Methoxy-1H-Indol-3-Yl]Ethyl]Acetamide; N-[2-[5-Methoxy-2-(Phenylmethyl)-1H-Indol-3-Yl]Ethyl]Ethanamide; 2-Benzyl-5-Methoxy-N-Acetyltryptamine |
| Molecular Structure |  |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 |
| CAS Registry Number | 122853-28-5 |
| SMILES | C1=C(OC)C=CC2=C1C(=C([NH]2)CC3=CC=CC=C3)CCNC(=O)C |
| InChI | 1S/C20H22N2O2/c1-14(23)21-11-10-17-18-13-16(24-2)8-9-19(18)22-20(17)12-15-6-4-3-5-7-15/h3-9,13,22H,10-12H2,1-2H3,(H,21,23) |
| InChIKey | MUQOTEHRXIKHKR-UHFFFAOYSA-N |
| Density | 1.164g/cm3 (Cal.) |
|---|---|
| Boiling point | 586.834°C at 760 mmHg (Cal.) |
| Flash point | 308.707°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methoxyluzindole |