Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl 4-(Sulfamoylamino)-3-Thiophenecarboxylate |
|---|---|
| Synonyms | methyl 4-(sulfamoylamino)thiophene-3-carboxylate |
| Molecular Structure |  |
| Molecular Formula | C6H8N2O4S2 |
| Molecular Weight | 236.27 |
| CAS Registry Number | 123420-28-0 |
| SMILES | O=C(OC)c1cscc1NS(N)(=O)=O |
| InChI | 1S/C6H8N2O4S2/c1-12-6(9)4-2-13-3-5(4)8-14(7,10)11/h2-3,8H,1H3,(H2,7,10,11) |
| InChIKey | IOYXBEDYGSFBAX-UHFFFAOYSA-N |
| Density | 1.635g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.555°C at 760 mmHg (Cal.) |
| Flash point | 208.145°C (Cal.) |
| Refractive index | 1.641 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 4-(Sulfamoylamino)-3-Thiophenecarboxylate |