|
CAS#: 1236-72-2 Product: 1,3,5(10)-Estratrien-2,3,16alpha,17beta-Tetrol 2-Methyl Ether No suppilers available for the product. |
| Name | 1,3,5(10)-Estratrien-2,3,16alpha,17beta-Tetrol 2-Methyl Ether |
|---|---|
| Synonyms | 2-Methoxyestriol; Estra-1,3,5(10)-Triene-3,16,17-Triol, 2-Methoxy-, (16Alpha,17Beta)-; 2-Meoe3 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 |
| CAS Registry Number | 1236-72-2 |
| SMILES | [C@@]14(C)[C@H]([C@H]3[C@H](CC1)C2=CC(=C(C=C2CC3)O)OC)C[C@H]([C@@H]4O)O |
| InChI | 1S/C19H26O4/c1-19-6-5-11-12(14(19)9-16(21)18(19)22)4-3-10-7-15(20)17(23-2)8-13(10)11/h7-8,11-12,14,16,18,20-22H,3-6,9H2,1-2H3/t11-,12+,14-,16+,18-,19-/m0/s1 |
| InChIKey | PEXPJFWTSZLEAQ-YSYMNNNUSA-N |
| Density | 1.255g/cm3 (Cal.) |
|---|---|
| Boiling point | 486.407°C at 760 mmHg (Cal.) |
| Flash point | 247.97°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,5(10)-Estratrien-2,3,16alpha,17beta-Tetrol 2-Methyl Ether |