Online Database of Chemicals from Around the World
|
CAS#: 123665-88-3 Product: 11-Hydroxytetradotoxin No suppilers available for the product. |
| Name | 11-Hydroxytetradotoxin |
|---|---|
| Synonyms | 11-Oxo-Tetrodotoxin; 11-Oxo-Ttx; 11-Oxotetrodotoxin |
| Molecular Structure |  |
| Molecular Formula | C11H17N3O9 |
| Molecular Weight | 335.27 |
| CAS Registry Number | 123665-88-3 |
| SMILES | OC1(C2OC4(OC1C(O)C3(NC(=NC(O)C23)N)C4O)O)C(O)O |
| InChI | 1S/C11H17N3O9/c12-8-13-5(16)1-3-10(20,7(18)19)4-2(15)9(1,14-8)6(17)11(21,22-3)23-4/h1-7,15-21H,(H3,12,13,14) |
| InChIKey | FPIMGHUQQSRSTB-UHFFFAOYSA-N |
| Density | 2.995g/cm3 (Cal.) |
|---|---|
| Boiling point | 798.472°C at 760 mmHg (Cal.) |
| Flash point | 436.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 11-Hydroxytetradotoxin |