Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Name | 3,22-Dihydroxyurs-12-en-30-oic acid |
|---|---|
| Synonyms | 3,22-Dihydroxyurs-12-En-30-Oic Acid; Urs-12-En-30-Oic Acid, 3,22-Dihydroxy-, (3Beta,22Alpha)- |
| Molecular Structure |  |
| Molecular Formula | C30H48O4 |
| Molecular Weight | 472.71 |
| CAS Registry Number | 123914-32-9 |
| SMILES | [C@@]13([C@]4(C(=CC[C@@H]1[C@@]2(C(C([C@@H](O)CC2)(C)C)CC3)C)[C@@H]5[C@@](CC4)([C@@H](O)C[C@H]([C@@H]5C)C(=O)O)C)C)C |
| InChI | 1S/C30H48O4/c1-17-18(25(33)34)16-23(32)28(5)14-15-29(6)19(24(17)28)8-9-21-27(4)12-11-22(31)26(2,3)20(27)10-13-30(21,29)7/h8,17-18,20-24,31-32H,9-16H2,1-7H3,(H,33,34)/t17-,18+,20?,21+,22-,23-,24+,27-,28-,29+,30+/m0/s1 |
| InChIKey | IWVWTVWLRSUYNC-ULUYBTNLSA-N |
| Density | 1.143g/cm3 (Cal.) |
|---|---|
| Boiling point | 587.511°C at 760 mmHg (Cal.) |
| Flash point | 323.152°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,22-Dihydroxyurs-12-en-30-oic acid |