Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Amadis Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 (571) 8992-5085 | |||
|
sales@amadischem.com | |||
 |
Skype Chat | |||
| Chemical manufacturer since 2011 | ||||
| Name | 2-Methyl-2-Propanyl [4-(2-Aminoethyl)Phenoxy]Acetate |
|---|---|
| Synonyms | 2-[4-(2-aminoethyl)phenoxy]acetic acid tert-butyl ester; tert-butyl 2-[4-(2-azanylethyl)phenoxy]ethanoate; Tert-Butyl[4-(2-aminoethyl)phenoxy]acetate |
| Molecular Structure | ![CAS#: 124499-19-0， 2-Methyl-2-Propanyl [4-(2-Aminoethyl)Phenoxy]Acetate](/moreStructures/124499-19-0.gif) |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.32 |
| CAS Registry Number | 124499-19-0 |
| SMILES | CC(C)(C)OC(=O)COc1ccc(cc1)CCN |
| InChI | 1S/C14H21NO3/c1-14(2,3)18-13(16)10-17-12-6-4-11(5-7-12)8-9-15/h4-7H,8-10,15H2,1-3H3 |
| InChIKey | YUDXZCVRFJCEAH-UHFFFAOYSA-N |
| Density | 1.065g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.967°C at 760 mmHg (Cal.) |
| Flash point | 127.339°C (Cal.) |
| Refractive index | 1.512 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-Propanyl [4-(2-Aminoethyl)Phenoxy]Acetate |