Online Database of Chemicals from Around the World
| Atlantic Research Chemicals Ltd. | UK | Inquire | ||
|---|---|---|---|---|
 |
+44 (8707) 746-454 | |||
 |
info@atlantic-chemicals.com | |||
| Chemical manufacturer | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 8-Hydroxy-2-Quinolinecarbonyl Chloride |
|---|---|
| Synonyms | 8-hydroxyquinoline-2-carbonyl chloride |
| Molecular Structure |  |
| Molecular Formula | C10H6ClNO2 |
| Molecular Weight | 207.61 |
| CAS Registry Number | 125686-91-1 |
| SMILES | c1cc2ccc(nc2c(c1)O)C(=O)Cl |
| InChI | 1S/C10H6ClNO2/c11-10(14)7-5-4-6-2-1-3-8(13)9(6)12-7/h1-5,13H |
| InChIKey | MLUUBRFEMCGPCV-UHFFFAOYSA-N |
| Density | 1.466g/cm3 (Cal.) |
|---|---|
| Boiling point | 391.925°C at 760 mmHg (Cal.) |
| Flash point | 190.829°C (Cal.) |
| Refractive index | 1.693 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 8-Hydroxy-2-Quinolinecarbonyl Chloride |