Online Database of Chemicals from Around the World
4,4,5,5-Tetramethyl-2-(5'-phenyl-[1,1':3',1''-terphenyl]-3-yl)-1,3,2-dioxaborolane
[CAS# 1257248-43-3]
Identification| Name | 4,4,5,5-Tetramethyl-2-(5'-phenyl-[1,1':3',1''-terphenyl]-3-yl)-1,3,2-dioxaborolane |
|---|
|
| Molecular Structure | ![CAS # 1257248-43-3, 4,4,5,5-Tetramethyl-2-(5'-phenyl-[1,1':3',1''-terphenyl]-3-yl)-1,3,2-dioxaborolane](/structures/1257248-43-3.gif) |
| Molecular Formula | C30H29BO2 |
| Molecular Weight | 432.36 |
| CAS Registry Number | 1257248-43-3 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C3=CC(=CC(=C3)C4=CC=CC=C4)C5=CC=CC=C5 |
|
Properties
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.618, Calc.* |
| Boiling Point | 582.6±29.0 °C (760 mmHg), Calc.* |
| Flash Point | 306.2±24.3 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Related Products
5,10,15,20-Tetr... 5,10,15,20-Tetr... 5,10,15,20-Tetr... 5,10,15,20-Tetr... 1,1,4,4-Tetrame... N-(2,3,5,6-Tetr... 4,4,5,5-Tetrame... N-[(2,3,5,6-Tet... 3-[[(2,3,5,6-Te... N-[(2,3,5,6-Tet... 1,3,5,7-Tetrame... N,N,N',N'-Tetra... Tetramethylphos... Tetramethylphos... Tetramethylphos... N,N,N',N'-Tetra... 2,2,6,6-Tetrame... 2,2,6,6-Tetrame... 3,3,5,5-Tetrame... 1,1,4,4-Tetrame...