Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-(3,4-Dihydroxyphenyl)-N,N-Dimethylpropanamide |
|---|---|
| Synonyms | 3-(3,4-dihydroxyphenyl)-N,N-dimethylpropanamide |
| Molecular Structure |  |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 |
| CAS Registry Number | 125789-96-0 |
| SMILES | CN(C)C(=O)CCc1ccc(c(c1)O)O |
| InChI | 1S/C11H15NO3/c1-12(2)11(15)6-4-8-3-5-9(13)10(14)7-8/h3,5,7,13-14H,4,6H2,1-2H3 |
| InChIKey | COGRRXGDGKANDV-UHFFFAOYSA-N |
| Density | 1.209g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.009°C at 760 mmHg (Cal.) |
| Flash point | 204.186°C (Cal.) |
| Refractive index | 1.576 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(3,4-Dihydroxyphenyl)-N,N-Dimethylpropanamide |