Online Database of Chemicals from Around the World
| Name | 4-(Dichloromethyl)-5H-Furan-2-One |
|---|---|
| Synonyms | 2(5H)-Furanone, 4-(Dichloromethyl)-; 4-(Dichloromethyl)-2(5H)-Furanone; Inchi=1/C5h4cl2o2/C6-5(7)3-1-4(8)9-2-3/H1,5H,2H |
| Molecular Structure |  |
| Molecular Formula | C5H4Cl2O2 |
| Molecular Weight | 166.99 |
| CAS Registry Number | 125974-00-7 |
| SMILES | O=C1OCC(=C1)C(Cl)Cl |
| InChI | 1S/C5H4Cl2O2/c6-5(7)3-1-4(8)9-2-3/h1,5H,2H2 |
| InChIKey | BDQBLTYYTURJQQ-UHFFFAOYSA-N |
| Density | 1.526g/cm3 (Cal.) |
|---|---|
| Boiling point | 270.38°C at 760 mmHg (Cal.) |
| Flash point | 130.417°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Dichloromethyl)-5H-Furan-2-One |
