Online Database of Chemicals from Around the World
|
CAS#: 126049-72-7 Product: 3-Hydroxy-N-(2-Oxooxolan-3-Yl)Butanamide No suppilers available for the product. |
| Name | 3-Hydroxy-N-(2-Oxooxolan-3-Yl)Butanamide |
|---|---|
| Synonyms | 3-Hydroxy-N-(2-Oxotetrahydrofuran-3-Yl)Butanamide; 3-Hydroxy-N-(2-Oxo-3-Tetrahydrofuranyl)Butanamide; 3-Hydroxy-N-(2-Ketotetrahydrofuran-3-Yl)Butyramide |
| Molecular Structure |  |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.20 |
| CAS Registry Number | 126049-72-7 |
| SMILES | C(C(=O)NC1C(OCC1)=O)C(O)C |
| InChI | 1S/C8H13NO4/c1-5(10)4-7(11)9-6-2-3-13-8(6)12/h5-6,10H,2-4H2,1H3,(H,9,11) |
| InChIKey | FIXDIFPJOFIIEC-UHFFFAOYSA-N |
| Density | 1.252g/cm3 (Cal.) |
|---|---|
| Boiling point | 504.621°C at 760 mmHg (Cal.) |
| Flash point | 258.986°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Hydroxy-N-(2-Oxooxolan-3-Yl)Butanamide |