Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N-Ethyl-N-[4-[(Methylsulfonyl)Amino]Phenyl]-Acetamide |
|---|---|
| Synonyms | N-Ethyl-N-[4-(Methylsulfonylamino)Phenyl]Ethanamide; Acetamide, N-Ethyl-N-(4-((Methylsulfonyl)Amino)Phenyl)- |
| Molecular Structure | ![CAS#: 126581-52-0， N-Ethyl-N-[4-[(Methylsulfonyl)Amino]Phenyl]-Acetamide](/moreStructures/126581-52-0.gif) |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.32 |
| CAS Registry Number | 126581-52-0 |
| SMILES | C1=CC(=CC=C1N(C(C)=O)CC)N[S](=O)(=O)C |
| InChI | 1S/C11H16N2O3S/c1-4-13(9(2)14)11-7-5-10(6-8-11)12-17(3,15)16/h5-8,12H,4H2,1-3H3 |
| InChIKey | RRMQZJCCMGMUJX-UHFFFAOYSA-N |
| Density | 1.294g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.659°C at 760 mmHg (Cal.) |
| Flash point | 202.16°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Ethyl-N-[4-[(Methylsulfonyl)Amino]Phenyl]-Acetamide |