Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Name | 1,3,5-Trimethyl-2-[(1E)-2-Nitro-1-Propen-1-Yl]Benzene |
|---|---|
| Molecular Structure | ![CAS#: 126760-70-1， 1,3,5-Trimethyl-2-[(1E)-2-Nitro-1-Propen-1-Yl]Benzene](/moreStructures/126760-70-1.gif) |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.25 |
| CAS Registry Number | 126760-70-1 |
| SMILES | [O-][N+](=O)/C(=C/c1c(cc(cc1C)C)C)C |
| InChI | 1S/C12H15NO2/c1-8-5-9(2)12(10(3)6-8)7-11(4)13(14)15/h5-7H,1-4H3/b11-7+ |
| InChIKey | CILKZWLODIJOFN-YRNVUSSQSA-N |
| Density | 1.07g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.747°C at 760 mmHg (Cal.) |
| Flash point | 129.087°C (Cal.) |
| Refractive index | 1.565 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,5-Trimethyl-2-[(1E)-2-Nitro-1-Propen-1-Yl]Benzene |