|
CAS#: 127283-63-0 Product: 7-Nitro-3,4-Dihydro-2H-1-Benzoxepin-5-One No suppilers available for the product. |
| Name | 7-Nitro-3,4-Dihydro-2H-1-Benzoxepin-5-One |
|---|---|
| Synonyms | Nsc734466; Nitrobenzooxipenone; 7-Nitro-3,4-Dihydro-2H-Benzo[B]Oxepine |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.19 |
| CAS Registry Number | 127283-63-0 |
| SMILES | C1=C2C(=CC=C1[N+]([O-])=O)OCCCC2=O |
| InChI | 1S/C10H9NO4/c12-9-2-1-5-15-10-4-3-7(11(13)14)6-8(9)10/h3-4,6H,1-2,5H2 |
| InChIKey | HCJDDRWAVYLBCZ-UHFFFAOYSA-N |
| Density | 1.351g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.28°C at 760 mmHg (Cal.) |
| Flash point | 193.807°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Nitro-3,4-Dihydro-2H-1-Benzoxepin-5-One |