Online Database of Chemicals from Around the World
|
CAS#: 127321-47-5 Product: 2'-Demethoxy-2'-Methyldehydrogriseofulvin No suppilers available for the product. |
| Name | 2'-Demethoxy-2'-Methyldehydrogriseofulvin |
|---|---|
| Synonyms | 7-Chloro-4,6-Dimethoxy-3',5'-Dimethyl-Spiro[Benzofuran-2,4'-Cyclohexa-2,5-Diene]-1',3-Dione; 7-Chloro-4,6-Dimethoxy-3',5'-Dimethylspiro[Benzofuran-2,4'-Cyclohexa-2,5-Diene]-1',3-Dione; 7-Chloro-4,6-Dimethoxy-3',5'-Dimethyl-Spiro[Benzofuran-2,4'-Cyclohexa-2,5-Diene]-1',3-Quinone |
| Molecular Structure |  |
| Molecular Formula | C17H15ClO5 |
| Molecular Weight | 334.76 |
| CAS Registry Number | 127321-47-5 |
| SMILES | C2=C(C(=C1OC3(C(C1=C2OC)=O)C(=CC(C=C3C)=O)C)Cl)OC |
| InChI | 1S/C17H15ClO5/c1-8-5-10(19)6-9(2)17(8)16(20)13-11(21-3)7-12(22-4)14(18)15(13)23-17/h5-7H,1-4H3 |
| InChIKey | YSXFOJNCGPZFFU-UHFFFAOYSA-N |
| Density | 1.385g/cm3 (Cal.) |
|---|---|
| Boiling point | 534.591°C at 760 mmHg (Cal.) |
| Flash point | 215.224°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2'-Demethoxy-2'-Methyldehydrogriseofulvin |