Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-[2-(Cyclopropylamino)-1-Hydroxyethyl]-1,2-Benzenediol |
|---|---|
| Synonyms | 4-(2-(cyclopropylamino)-1-hydroxyethyl)benzene-1,2-diol |
| Molecular Structure | ![CAS#: 127560-11-6， 4-[2-(Cyclopropylamino)-1-Hydroxyethyl]-1,2-Benzenediol](/moreStructures/127560-11-6.gif) |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 |
| CAS Registry Number | 127560-11-6 |
| SMILES | OC(c1cc(O)c(O)cc1)CNC2CC2 |
| InChI | 1S/C11H15NO3/c13-9-4-1-7(5-10(9)14)11(15)6-12-8-2-3-8/h1,4-5,8,11-15H,2-3,6H2 |
| InChIKey | KBZMDEIVCSSUOH-UHFFFAOYSA-N |
| Density | 1.357g/cm3 (Cal.) |
|---|---|
| Boiling point | 462.168°C at 760 mmHg (Cal.) |
| Flash point | 221.916°C (Cal.) |
| Refractive index | 1.647 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[2-(Cyclopropylamino)-1-Hydroxyethyl]-1,2-Benzenediol |