|
CAS#: 12769-01-6 Product: 3,3'-[(2-Methyl-1,3-Phenylene)Diimino]Bis(4,5,6,7-Tetrachloro-1H-Isoindol-1-One) No suppilers available for the product. |
| Name | 3,3'-[(2-Methyl-1,3-Phenylene)Diimino]Bis(4,5,6,7-Tetrachloro-1H-Isoindol-1-One) |
|---|---|
| Synonyms | 1H-Isoind |
| Molecular Structure | ![]() |
| Molecular Formula | C23H8Cl8N4O2 |
| Molecular Weight | 655.96 |
| CAS Registry Number | 12769-01-6 |
| SMILES | Clc1c/2c(c(Cl)c(Cl)c1Cl)C(=O)\N=C\2Nc3cccc(c3C)NC/4=N/C(=O)c5c\4c(Cl)c(Cl)c(Cl)c5Cl |
| InChI | 1S/C23H8Cl8N4O2/c1-5-6(32-20-8-10(22(36)34-20)14(26)18(30)16(28)12(8)24)3-2-4-7(5)33-21-9-11(23(37)35-21)15(27)19(31)17(29)13(9)25/h2-4H,1H3,(H,32,34,36)(H,33,35,37) |
| InChIKey | WZSFTHVIIGGDOI-UHFFFAOYSA-N |
| Density | 1.892g/cm3 (Cal.) |
|---|---|
| Boiling point | 799.335°C at 760 mmHg (Cal.) |
| Flash point | 437.222°C (Cal.) |
| Refractive index | 1.786 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3'-[(2-Methyl-1,3-Phenylene)Diimino]Bis(4,5,6,7-Tetrachloro-1H-Isoindol-1-One) |