| Name | 2-Ethyl-6-Nitro-2,3-Dihydroimidazo[2,1-b][1,3]Oxazole |
|---|---|
| Synonyms | 2-Ethyl-6-Nitro-2,3-Dihydroimidazo[2,1-B]Oxazole; 2-Ethyl-5-Nitro-2,3-Dihydroimidazo[2,1-B]Oxazole; Aids-009195 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 |
| CAS Registry Number | 127692-13-1 |
| SMILES | C1=C(N=C2[N]1CC(CC)O2)[N+]([O-])=O |
| InChI | 1S/C7H9N3O3/c1-2-5-3-9-4-6(10(11)12)8-7(9)13-5/h4-5H,2-3H2,1H3 |
| InChIKey | AEKVVFWCBKEYSC-UHFFFAOYSA-N |
| Density | 1.597g/cm3 (Cal.) |
|---|---|
| Boiling point | 340°C at 760 mmHg (Cal.) |
| Flash point | 159.426°C (Cal.) |
| (1) | Philip Prathipati, Ngai Ling Ma* and Thomas H. Keller. Global Bayesian Models for the Prioritization of Antitubercular Agents, J. Chem. Inf. Model., 2008, 48 (12), pp 2362–2370 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Ethyl-6-Nitro-2,3-Dihydroimidazo[2,1-b][1,3]Oxazole |