Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Acetyl-6-Methyl-2,4-Piperidinedione |
|---|---|
| Synonyms | 3-acetyl-6-methylpiperidine-2,4-dione |
| Molecular Structure |  |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 |
| CAS Registry Number | 127952-78-7 |
| SMILES | CC1CC(=O)C(C(=O)N1)C(=O)C |
| InChI | 1S/C8H11NO3/c1-4-3-6(11)7(5(2)10)8(12)9-4/h4,7H,3H2,1-2H3,(H,9,12) |
| InChIKey | MCCJLHUBNQHMKV-UHFFFAOYSA-N |
| Density | 1.153g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.2°C at 760 mmHg (Cal.) |
| Flash point | 189.96°C (Cal.) |
| Refractive index | 1.465 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Acetyl-6-Methyl-2,4-Piperidinedione |