| Shanghai Rui Yun Chemical Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.rychemical.com.cn | |||
![]() | +86 (21) 6726-7633 | |||
![]() | +86 (21) 6726-7655 | |||
![]() | sales@rychemical.com.cn | |||
![]() | WeChat: 13917251563 | |||
| Chemical manufacturer since 2009 | ||||
| chemBlink Premium supplier since 2009 | ||||
| Classification | Organic raw materials >> Aryl compounds >> Naphthalenes |
|---|---|
| Name | 1-Cyclopropyl-4-bromonaphthalene |
| Synonyms | 1-bromo-4-cyclopropylnaphthalene |
| Molecular Structure | ![]() |
| Molecular Formula | C13H11Br |
| Molecular Weight | 247.13 |
| CAS Registry Number | 127971-24-8 |
| SMILES | C1CC1C2=CC=C(C3=CC=CC=C23)Br |
| Solubility | Insoluble (4.4E-4 g/L) (25 °C), Calc.* |
|---|---|
| Density | 1.473±0.06 g/cm3 (20 °C 760 Torr), Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software V11.02 (©1994-2016 ACD/Labs) |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 Details |
| SDS | Available |
|
1-Cyclopropyl-4-bromonaphthalene is a specialized organic compound characterized by the presence of a cyclopropyl group and a bromine atom attached to a naphthalene ring. With the molecular formula C₁₂H₉Br, this compound is part of a broader class of naphthalene derivatives known for their diverse chemical properties and applications. The synthesis of 1-Cyclopropyl-4-bromonaphthalene typically involves the bromination of naphthalene derivatives followed by cyclopropylation. The bromination process introduces a bromine atom at the 4-position of the naphthalene ring, while the cyclopropyl group is introduced via a cyclopropylation reaction. This method enables the creation of the compound with high selectivity and efficiency. The discovery and development of 1-Cyclopropyl-4-bromonaphthalene can be traced back to studies focused on modifying naphthalene to enhance its chemical reactivity and functional properties. Researchers have explored the incorporation of various functional groups into the naphthalene structure to create compounds with novel properties and applications. One of the primary applications of 1-Cyclopropyl-4-bromonaphthalene lies in its use as an intermediate in organic synthesis. The bromine atom and cyclopropyl group confer unique reactivity to the compound, making it a valuable building block for the synthesis of more complex molecules. In particular, 1-Cyclopropyl-4-bromonaphthalene is utilized in the creation of pharmaceuticals and agrochemicals, where its functional groups play a crucial role in imparting desired properties to the final products. In pharmaceutical chemistry, 1-Cyclopropyl-4-bromonaphthalene serves as a precursor for the synthesis of compounds with potential therapeutic applications. The cyclopropyl and bromine groups can influence the biological activity and binding properties of the resulting molecules, making this compound useful in drug discovery and development. Researchers leverage its reactivity to design and synthesize novel compounds with specific pharmacological activities. In agrochemical applications, 1-Cyclopropyl-4-bromonaphthalene is employed to create substances with pesticidal properties. The compound's ability to participate in further chemical transformations allows for the development of agrochemicals that are effective in controlling pests and diseases in crops. The structural features of 1-Cyclopropyl-4-bromonaphthalene contribute to the efficacy and stability of these agrochemical products. Additionally, 1-Cyclopropyl-4-bromonaphthalene is valuable in the study of chemical reactions and mechanisms. Its distinct functional groups provide a platform for investigating reaction pathways and developing new synthetic methodologies. Researchers use the compound to explore novel reaction conditions and optimize synthetic routes for various applications. Overall, 1-Cyclopropyl-4-bromonaphthalene is a compound with significant applications in organic synthesis, pharmaceuticals, and agrochemicals. Its role as an intermediate highlights its importance in the development of new chemical products and materials. |
| Market Analysis Reports |