Online Database of Chemicals from Around the World
|
CAS#: 128129-42-0 Product: 3-Methoxysampangine No suppilers available for the product. |
| Name | 3-Methoxysampangine |
|---|---|
| Synonyms | Aids008491; 7H-Naphtho(1,2,3-Ij)(2,7)Naphthyridin-7-One, 3-Methoxy-; 3-Methoxysampangine |
| Molecular Structure |  |
| Molecular Formula | C16H10N2O2 |
| Molecular Weight | 262.27 |
| CAS Registry Number | 128129-42-0 |
| SMILES | C2=C(C1=CC=NC4=C1C(=N2)C3=CC=CC=C3C4=O)OC |
| InChI | 1S/C16H10N2O2/c1-20-12-8-18-14-9-4-2-3-5-10(9)16(19)15-13(14)11(12)6-7-17-15/h2-8H,1H3 |
| InChIKey | FBVVMYZYZXYLIA-UHFFFAOYSA-N |
| Density | 1.385g/cm3 (Cal.) |
|---|---|
| Boiling point | 525.581°C at 760 mmHg (Cal.) |
| Flash point | 271.662°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methoxysampangine |