| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 6-Bromo-1,1,1,2,2,3,3-Heptafluoro-4,4-Bis(Trifluoromethyl)Hexane |
|---|---|
| Synonyms | 1-Bromo-4 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H4BrF13 |
| Molecular Weight | 427.00 |
| CAS Registry Number | 128454-91-1 |
| SMILES | FC(F)(C(F)(F)C(F)(F)F)C(CCBr)(C(F)(F)F)C(F)(F)F |
| InChI | 1S/C8H4BrF13/c9-2-1-3(6(14,15)16,7(17,18)19)4(10,11)5(12,13)8(20,21)22/h1-2H2 |
| InChIKey | UVKBMPCVVMQGLN-UHFFFAOYSA-N |
| Density | 1.744g/cm3 (Cal.) |
|---|---|
| Boiling point | 159.794°C at 760 mmHg (Cal.) |
| Flash point | 50.442°C (Cal.) |
| Refractive index | 1.321 (Cal.) |
| Safety Description | Irritant |
|---|---|
| S23,S24/25,S36/37/39,S45 | |
| R36/37/38 | |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 6-Bromo-1,1,1,2,2,3,3-Heptafluoro-4,4-Bis(Trifluoromethyl)Hexane |