Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Porphyrin Systems | Germany | Inquire | ||
|---|---|---|---|---|
|
+49 (40) 6466-5860 | |||
|
hombrecher@porphyrin-systems.de | |||
| Chemical manufacturer since 1999 | ||||
| Name | Ethyl 2,4,5,6-Tetrahydrocyclopenta[c]Pyrrole-1-Carboxylate |
|---|---|
| Synonyms | ethyl 2,4,5,6-tetrahydrocyclopenta[c]pyrrole-1-carboxylate |
| Molecular Structure | ![CAS#: 128812-35-1， Ethyl 2,4,5,6-Tetrahydrocyclopenta[c]Pyrrole-1-Carboxylate](/moreStructures/128812-35-1.gif) |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 |
| CAS Registry Number | 128812-35-1 |
| SMILES | CCOC(=O)c1c2c(c[nH]1)CCC2 |
| InChI | 1S/C10H13NO2/c1-2-13-10(12)9-8-5-3-4-7(8)6-11-9/h6,11H,2-5H2,1H3 |
| InChIKey | VOQBTLZBLJPLNW-UHFFFAOYSA-N |
| Density | 1.185g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.485°C at 760 mmHg (Cal.) |
| Flash point | 165.768°C (Cal.) |
| Refractive index | 1.565 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2,4,5,6-Tetrahydrocyclopenta[c]Pyrrole-1-Carboxylate |