Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-[(E)-(1-Chloropropylidene)(Oxido)-lambda5-Azanyl]-2-Methyl-1-Propanone |
|---|---|
| Molecular Structure | ![CAS#: 129078-64-4， 1-[(E)-(1-Chloropropylidene)(Oxido)-lambda<Sup>5</Sup>-Azanyl]-2-Methyl-1-Propanone](/moreStructures/129078-64-4.gif) |
| Molecular Formula | C7H12ClNO2 |
| Molecular Weight | 177.63 |
| CAS Registry Number | 129078-64-4 |
| SMILES | CC/C(=[N+](/C(=O)C(C)C)\[O-])/Cl |
| InChI | 1S/C7H12ClNO2/c1-4-6(8)9(11)7(10)5(2)3/h5H,4H2,1-3H3/b9-6+ |
| InChIKey | NGYGVQPSGGRRRT-RMKNXTFCSA-N |
| Density | 1.098g/cm3 (Cal.) |
|---|---|
| Boiling point | 258.492°C at 760 mmHg (Cal.) |
| Flash point | 110.132°C (Cal.) |
| Refractive index | 1.469 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(E)-(1-Chloropropylidene)(Oxido)-lambda5-Azanyl]-2-Methyl-1-Propanone |