Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (3S,4S)-4-Isopropyl-3-Vinylcyclohexanone |
|---|---|
| Synonyms | (3S,4S)-4-isopropyl-3-vinylcyclohexanone |
| Molecular Structure |  |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 |
| CAS Registry Number | 129215-01-6 |
| SMILES | CC(C)[C@@H]1CCC(=O)C[C@H]1\C=C |
| InChI | 1S/C11H18O/c1-4-9-7-10(12)5-6-11(9)8(2)3/h4,8-9,11H,1,5-7H2,2-3H3/t9-,11+/m1/s1 |
| InChIKey | QXNSYXCBSUUXGY-KOLCDFICSA-N |
| Density | 0.945g/cm3 (Cal.) |
|---|---|
| Boiling point | 232.541°C at 760 mmHg (Cal.) |
| Flash point | 87.832°C (Cal.) |
| Refractive index | 1.508 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3S,4S)-4-Isopropyl-3-Vinylcyclohexanone |