|
CAS#: 1293-73-8 Product: titanocene dibromide No suppilers available for the product. |
| Name | titanocene dibromide |
|---|---|
| Synonyms | (C2H5)2TiBr2; Bis(η5-cyclopentadienyl)titanium dibromide; Titanium, dibromobis(η5-2,4-cyclopentadien-1-yl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10Br2Ti |
| Molecular Weight | 337.86 |
| CAS Registry Number | 1293-73-8 |
| SMILES | Br[Ti]Br.[CH-]1[CH-][CH-][CH-][CH-]1.c1[c-]ccc1 |
| InChI | 1S/2C5H5.2BrH.Ti/c2*1-2-4-5-3-1;;;/h2*1-5H;2*1H;/q-5;-1;;;+2/p-2 |
| InChIKey | LUSNBRYWOSDOGM-UHFFFAOYSA-L |
| Boiling point | 41.5°C at 760 mmHg (Cal.) |
|---|---|
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for titanocene dibromide |