Online Database of Chemicals from Around the World
|
CAS#: 129644-69-5 Product: 2,6-Dimethyl-4-[(Trifluoromethyl)Sulfanyl]Phenol No suppilers available for the product. |
| Name | 2,6-Dimethyl-4-[(Trifluoromethyl)Sulfanyl]Phenol |
|---|---|
| Synonyms | 2,6-Dimethyl-4-(trifluoromethylthio)phenol |
| Molecular Structure | ![CAS#: 129644-69-5， 2,6-Dimethyl-4-[(Trifluoromethyl)Sulfanyl]Phenol](/moreStructures/129644-69-5.gif) |
| Molecular Formula | C9H9F3OS |
| Molecular Weight | 222.23 |
| CAS Registry Number | 129644-69-5 |
| SMILES | CC1=CC(=CC(=C1O)C)SC(F)(F)F |
| InChI | 1S/C9H9F3OS/c1-5-3-7(14-9(10,11)12)4-6(2)8(5)13/h3-4,13H,1-2H3 |
| InChIKey | CKYSTCDWANUKMK-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 195.5±40.0°C at 760 mmHg (Cal.) |
| Flash point | 72.0±27.3°C (Cal.) |
| Refractive index | 1.522 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Dimethyl-4-[(Trifluoromethyl)Sulfanyl]Phenol |