Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (5R,8aR)-Octahydro-5-Indolizinecarbonitrile |
|---|---|
| Synonyms | (5R,8aR)-octahydroindolizine-5-carbonitrile |
| Molecular Structure |  |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 |
| CAS Registry Number | 129708-97-0 |
| SMILES | C1C[C@@H]2CCCN2[C@H](C1)C#N |
| InChI | 1S/C9H14N2/c10-7-9-4-1-3-8-5-2-6-11(8)9/h8-9H,1-6H2/t8-,9-/m1/s1 |
| InChIKey | PTUDGSXGCPOVJY-RKDXNWHRSA-N |
| Density | 1.061g/cm3 (Cal.) |
|---|---|
| Boiling point | 267.128°C at 760 mmHg (Cal.) |
| Flash point | 111.792°C (Cal.) |
| Refractive index | 1.525 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (5R,8aR)-Octahydro-5-Indolizinecarbonitrile |