| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Classification | Analytical chemistry >> Standard >> Forensic and veterinary standards |
|---|---|
| Name | (5R,6R)-7-Ethyl-5-(3-Hydroxybenzoyl)Oxy-7-Azabicyclo[2.2.1]Heptane-6-Carboxylic Acid |
| Synonyms | (5R,6R)-7-Ethyl-5-[(3-Hydroxyphenyl)-Oxomethoxy]-7-Azabicyclo[2.2.1]Heptane-6-Carboxylic Acid; (5R,6R)-7-Ethyl-5-(3-Hydroxyphenyl)Carbonyloxy-7-Azabicyclo[2.2.1]Heptane-6-Carboxylic Acid; (1R-(Exo,Exo))-3-((3-Hydroxybenzoyl)Oxy)-8-Methyl-8-Azabicyclo(3.2.1)Octane-2-Carboxylic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 |
| CAS Registry Number | 129944-99-6 |
| SMILES | N2(C3[C@H](OC(=O)C1=CC(=CC=C1)O)[C@@H](C2CC3)C(=O)O)CC |
| InChI | 1S/C16H19NO5/c1-2-17-11-6-7-12(17)14(13(11)15(19)20)22-16(21)9-4-3-5-10(18)8-9/h3-5,8,11-14,18H,2,6-7H2,1H3,(H,19,20)/t11?,12?,13-,14+/m1/s1 |
| InChIKey | PAUMUFOIQAOWRE-PQAZSJQKSA-N |
| Density | 1.388g/cm3 (Cal.) |
|---|---|
| Boiling point | 513.948°C at 760 mmHg (Cal.) |
| Flash point | 264.626°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (5R,6R)-7-Ethyl-5-(3-Hydroxybenzoyl)Oxy-7-Azabicyclo[2.2.1]Heptane-6-Carboxylic Acid |