Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Dilithium Glycerophosphate |
|---|---|
| Synonyms | Dilithium Glyceryl Phosphate; Dilithium Glycerophosphate |
| Molecular Structure |  |
| Molecular Formula | C3H7Li2O6P |
| Molecular Weight | 183.94 |
| CAS Registry Number | 1300-23-8 |
| EINECS | 215-078-3 |
| SMILES | C(O[P]([O-])([O-])=O)C(O)CO.[Li+].[Li+] |
| InChI | 1S/C3H9O6P.2Li/c4-1-3(5)2-9-10(6,7)8;;/h3-5H,1-2H2,(H2,6,7,8);;/q;2*+1/p-2 |
| InChIKey | JZJVSRKZXGLAMI-UHFFFAOYSA-L |
| Boiling point | 485.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 247.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dilithium Glycerophosphate |