Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (1S,2S)-2-Chloro-2-Fluoro-1-Methylcyclopropanecarbonyl Chloride |
|---|---|
| Synonyms | (1S,2S)-2 |
| Molecular Structure |  |
| Molecular Formula | C5H5Cl2FO |
| Molecular Weight | 171.00 |
| CAS Registry Number | 130340-07-7 |
| SMILES | C[C@]1(C[C@]1(F)Cl)C(=O)Cl |
| InChI | 1S/C5H5Cl2FO/c1-4(3(6)9)2-5(4,7)8/h2H2,1H3/t4-,5+/m0/s1 |
| InChIKey | PFIHCNJKOIKNPW-CRCLSJGQSA-N |
| Density | 1.436g/cm3 (Cal.) |
|---|---|
| Boiling point | 162.341°C at 760 mmHg (Cal.) |
| Flash point | 51.983°C (Cal.) |
| Refractive index | 1.467 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1S,2S)-2-Chloro-2-Fluoro-1-Methylcyclopropanecarbonyl Chloride |